C23H46O4Si — CID 102368445
1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]undecan-2-one (PubChem CID 102368445) has the molecular formula C23H46O4Si and a molecular weight of 414.70 g/mol. Its IUPAC name is 1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]undecan-2-one.
| Compound Name | 1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]undecan-2-one |
|---|---|
| PubChem CID | 102368445 |
| Molecular Formula | C23H46O4Si |
| Molecular Weight | 414.70 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | 1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]undecan-2-one |
| SMILES | CCCCCCCCCC(=O)C[C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O4Si/c1-9-10-11-12-13-14-15-16-19(24)17-20-21(27-23(5,6)26-20)18-25-28(7,8)22(2,3)4/h20-21H,9-18H2,1-8H3/t20-,21-/m0/s1 |
| InChIKey | BZYJOIREYCEZMX-SFTDATJTSA-N |
| XLogP | 6.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.70 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|