C14H28O4Si — CID 134856017
1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dioxolan-2-yl]propan-2-one (PubChem CID 134856017) has the molecular formula C14H28O4Si and a molecular weight of 288.46 g/mol. Its IUPAC name is 1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dioxolan-2-yl]propan-2-one.
| Compound Name | 1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dioxolan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 134856017 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dioxolan-2-yl]propan-2-one |
| SMILES | CC(=O)CC1(CCO[Si](C)(C)C(C)(C)C)OCCO1 |
| InChI | InChI=1S/C14H28O4Si/c1-12(15)11-14(16-9-10-17-14)7-8-18-19(5,6)13(2,3)4/h7-11H2,1-6H3 |
| InChIKey | AEQLYKPRSLFKFP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|