C15H28O5Si — CID 10990729
(1R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butane-2,3-dione (PubChem CID 10990729) has the molecular formula C15H28O5Si and a molecular weight of 316.47 g/mol. Its IUPAC name is (1R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butane-2,3-dione.
| Compound Name | (1R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butane-2,3-dione |
|---|---|
| PubChem CID | 10990729 |
| Molecular Formula | C15H28O5Si |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (1R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butane-2,3-dione |
| SMILES | CC(=O)C(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C15H28O5Si/c1-10(16)12(17)13(11-9-18-15(5,6)19-11)20-21(7,8)14(2,3)4/h11,13H,9H2,1-8H3/t11-,13-/m1/s1 |
| InChIKey | HRCODFGMUAEOEG-DGCLKSJQSA-N |
| XLogP | 2.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|