C14H28O4Si — CID 102368689
(E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethoxyhex-4-en-3-one (PubChem CID 102368689) has the molecular formula C14H28O4Si and a molecular weight of 288.46 g/mol. Its IUPAC name is (E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethoxyhex-4-en-3-one.
| Compound Name | (E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethoxyhex-4-en-3-one |
|---|---|
| PubChem CID | 102368689 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethoxyhex-4-en-3-one |
| SMILES | COC(/C=C/C(=O)[C@H](C)O[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C14H28O4Si/c1-11(18-19(7,8)14(2,3)4)12(15)9-10-13(16-5)17-6/h9-11,13H,1-8H3/b10-9+/t11-/m0/s1 |
| InChIKey | ZVGOAHCQTRKWMM-USKTWTLRSA-N |
| XLogP | 3.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|