C17H32O5Si — CID 11405218
(3R,5E)-7-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)hepta-1,5-dien-4-one (PubChem CID 11405218) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is (3R,5E)-7-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)hepta-1,5-dien-4-one.
| Compound Name | (3R,5E)-7-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)hepta-1,5-dien-4-one |
|---|---|
| PubChem CID | 11405218 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (3R,5E)-7-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)hepta-1,5-dien-4-one |
| SMILES | C=C[C@@H](OCOCCOC)C(=O)/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O5Si/c1-8-16(21-14-20-13-12-19-5)15(18)10-9-11-22-23(6,7)17(2,3)4/h8-10,16H,1,11-14H2,2-7H3/b10-9+/t16-/m1/s1 |
| InChIKey | DZYVEHVQQOMSKG-ZNFPLGDCSA-N |
| XLogP | 3.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|