C22H23NO4S — CID 102368807
N-benzyl-4-methoxy-N-[(Z)-1-(5-oxocyclopenten-1-yl)prop-1-enyl]benzenesulfonamide (PubChem CID 102368807) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-benzyl-4-methoxy-N-[(Z)-1-(5-oxocyclopenten-1-yl)prop-1-enyl]benzenesulfonamide.
| Compound Name | N-benzyl-4-methoxy-N-[(Z)-1-(5-oxocyclopenten-1-yl)prop-1-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102368807 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | N-benzyl-4-methoxy-N-[(Z)-1-(5-oxocyclopenten-1-yl)prop-1-enyl]benzenesulfonamide |
| SMILES | C/C=C(/C1=CCCC1=O)N(Cc1ccccc1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H23NO4S/c1-3-21(20-10-7-11-22(20)24)23(16-17-8-5-4-6-9-17)28(25,26)19-14-12-18(27-2)13-15-19/h3-6,8-10,12-15H,7,11,16H2,1-2H3/b21-3- |
| InChIKey | KCVGHAYCIDAADL-OSSHXBFKSA-N |
| XLogP | 4.08 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |