C29H48O4Si — CID 102368808
methyl (2S,5R,6R,7R,10R,12S)-5-ethenyl-5-methyl-9-oxo-12-tri(propan-2-yl)silyloxytricyclo[8.4.1.02,7]pentadec-1(14)-ene-6-carboxylate (PubChem CID 102368808) has the molecular formula C29H48O4Si and a molecular weight of 488.79 g/mol. Its IUPAC name is methyl (2S,5R,6R,7R,10R,12S)-5-ethenyl-5-methyl-9-oxo-12-tri(propan-2-yl)silyloxytricyclo[8.4.1.02,7]pentadec-1(14)-ene-6-carboxylate.
| Compound Name | methyl (2S,5R,6R,7R,10R,12S)-5-ethenyl-5-methyl-9-oxo-12-tri(propan-2-yl)silyloxytricyclo[8.4.1.02,7]pentadec-1(14)-ene-6-carboxylate |
|---|---|
| PubChem CID | 102368808 |
| Molecular Formula | C29H48O4Si |
| Molecular Weight | 488.79 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | methyl (2S,5R,6R,7R,10R,12S)-5-ethenyl-5-methyl-9-oxo-12-tri(propan-2-yl)silyloxytricyclo[8.4.1.02,7]pentadec-1(14)-ene-6-carboxylate |
| SMILES | C=C[C@@]1(C)CC[C@@H]2C3=CC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C[C@@H](C3)C(=O)C[C@H]2[C@H]1C(=O)OC |
| InChI | InChI=1S/C29H48O4Si/c1-10-29(8)14-13-24-21-11-12-23(33-34(18(2)3,19(4)5)20(6)7)16-22(15-21)26(30)17-25(24)27(29)28(31)32-9/h10-11,18-20,22-25,27H,1,12-17H2,2-9H3/t22-,23+,24-,25-,27+,29+/m1/s1 |
| InChIKey | MRSXBUHRROQJQB-MYQZWLHRSA-N |
| XLogP | 7.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.79 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|