C24H42O4Si — CID 11683249
ethyl (1R,2S,4aR,6S,8aS)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3,6-trimethyl-5-oxo-2,4a,6,7,8,8a-hexahydronaphthalene-1-carboxylate (PubChem CID 11683249) has the molecular formula C24H42O4Si and a molecular weight of 422.68 g/mol. Its IUPAC name is ethyl (1R,2S,4aR,6S,8aS)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3,6-trimethyl-5-oxo-2,4a,6,7,8,8a-hexahydronaphthalene-1-carboxylate.
| Compound Name | ethyl (1R,2S,4aR,6S,8aS)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3,6-trimethyl-5-oxo-2,4a,6,7,8,8a-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11683249 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | ethyl (1R,2S,4aR,6S,8aS)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3,6-trimethyl-5-oxo-2,4a,6,7,8,8a-hexahydronaphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)[C@@H](CCO[Si](C)(C)C(C)(C)C)C(C)=C[C@H]2C(=O)[C@@H](C)CC[C@@H]21 |
| InChI | InChI=1S/C24H42O4Si/c1-10-27-22(26)24(7)19(13-14-28-29(8,9)23(4,5)6)17(3)15-18-20(24)12-11-16(2)21(18)25/h15-16,18-20H,10-14H2,1-9H3/t16-,18+,19-,20-,24-/m0/s1 |
| InChIKey | AMFKFQOYQTZUTL-ZGXSGVJPSA-N |
| XLogP | 5.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|