C34H58O6Si — CID 134922375
methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(1S,2S,6S,8S)-8-(2,2-dimethylbutanoyloxy)-2-methyl-6-[(E)-prop-1-enyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-5-oxoheptanoate (PubChem CID 134922375) has the molecular formula C34H58O6Si and a molecular weight of 590.92 g/mol. Its IUPAC name is methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(1S,2S,6S,8S)-8-(2,2-dimethylbutanoyloxy)-2-methyl-6-[(E)-prop-1-enyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-5-oxoheptanoate.
| Compound Name | methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(1S,2S,6S,8S)-8-(2,2-dimethylbutanoyloxy)-2-methyl-6-[(E)-prop-1-enyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-5-oxoheptanoate |
|---|---|
| PubChem CID | 134922375 |
| Molecular Formula | C34H58O6Si |
| Molecular Weight | 590.92 g/mol |
| Exact Mass | 590.40 |
| IUPAC Name | methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(1S,2S,6S,8S)-8-(2,2-dimethylbutanoyloxy)-2-methyl-6-[(E)-prop-1-enyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-5-oxoheptanoate |
| SMILES | C/C=C/[C@H]1CC2C=C[C@H](C)[C@H](CCC(=O)C[C@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C)C2C(OC(=O)C(C)(C)CC)C1 |
| InChI | InChI=1S/C34H58O6Si/c1-12-14-24-19-25-16-15-23(3)28(31(25)29(20-24)39-32(37)34(7,8)13-2)18-17-26(35)21-27(22-30(36)38-9)40-41(10,11)33(4,5)6/h12,14-16,23-25,27-29,31H,13,17-22H2,1-11H3/b14-12+/t23-,24-,25?,27+,28-,29?,31?/m0/s1 |
| InChIKey | MZTVTZVZCMEPAM-QZBARPDUSA-N |
| XLogP | 8.07 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.92 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|