C24H42O3Si — CID 10250799
ethyl (1S,2S,4aR,6S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-6-[(E)-prop-1-enyl]-2,4a,5,7,8,8a-hexahydro-1H-naphthalene-1-carboxylate (PubChem CID 10250799) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is ethyl (1S,2S,4aR,6S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-6-[(E)-prop-1-enyl]-2,4a,5,7,8,8a-hexahydro-1H-naphthalene-1-carboxylate.
| Compound Name | ethyl (1S,2S,4aR,6S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-6-[(E)-prop-1-enyl]-2,4a,5,7,8,8a-hexahydro-1H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 10250799 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | ethyl (1S,2S,4aR,6S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-6-[(E)-prop-1-enyl]-2,4a,5,7,8,8a-hexahydro-1H-naphthalene-1-carboxylate |
| SMILES | C/C=C/[C@]1(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2[C@@H](C(=O)OCC)[C@@H](C)C=C[C@H]2C1 |
| InChI | InChI=1S/C24H42O3Si/c1-10-14-24(7)15-18-13-12-17(3)20(22(25)26-11-2)21(18)19(16-24)27-28(8,9)23(4,5)6/h10,12-14,17-21H,11,15-16H2,1-9H3/b14-10+/t17-,18-,19-,20-,21+,24-/m0/s1 |
| InChIKey | LJHGQKAOKZWCET-QEQIKPGMSA-N |
| XLogP | 6.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|