C32H54O4Si — CID 102368810
methyl (2S,5R,6R,7R,10R,12S)-5-methyl-5-[(E)-3-methylbut-1-enyl]-9-oxo-12-tri(propan-2-yl)silyloxytricyclo[8.4.1.02,7]pentadec-1(14)-ene-6-carboxylate (PubChem CID 102368810) has the molecular formula C32H54O4Si and a molecular weight of 530.87 g/mol. Its IUPAC name is methyl (2S,5R,6R,7R,10R,12S)-5-methyl-5-[(E)-3-methylbut-1-enyl]-9-oxo-12-tri(propan-2-yl)silyloxytricyclo[8.4.1.02,7]pentadec-1(14)-ene-6-carboxylate.
| Compound Name | methyl (2S,5R,6R,7R,10R,12S)-5-methyl-5-[(E)-3-methylbut-1-enyl]-9-oxo-12-tri(propan-2-yl)silyloxytricyclo[8.4.1.02,7]pentadec-1(14)-ene-6-carboxylate |
|---|---|
| PubChem CID | 102368810 |
| Molecular Formula | C32H54O4Si |
| Molecular Weight | 530.87 g/mol |
| Exact Mass | 530.38 |
| IUPAC Name | methyl (2S,5R,6R,7R,10R,12S)-5-methyl-5-[(E)-3-methylbut-1-enyl]-9-oxo-12-tri(propan-2-yl)silyloxytricyclo[8.4.1.02,7]pentadec-1(14)-ene-6-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2CC(=O)[C@@H]3CC(=CC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C3)[C@H]2CC[C@]1(C)/C=C/C(C)C |
| InChI | InChI=1S/C32H54O4Si/c1-20(2)13-15-32(9)16-14-27-24-11-12-26(36-37(21(3)4,22(5)6)23(7)8)18-25(17-24)29(33)19-28(27)30(32)31(34)35-10/h11,13,15,20-23,25-28,30H,12,14,16-19H2,1-10H3/b15-13+/t25-,26+,27-,28-,30+,32+/m1/s1 |
| InChIKey | KZVXGDGGFTWUES-CUCXZLSASA-N |
| XLogP | 8.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.87 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|