C25H19N3O2 — CID 102369656
2-oxo-N,4-diphenyl-6-[(E)-2-phenylethenyl]-1H-pyrimidine-5-carboxamide (PubChem CID 102369656) has the molecular formula C25H19N3O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is 2-oxo-N,4-diphenyl-6-[(E)-2-phenylethenyl]-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-oxo-N,4-diphenyl-6-[(E)-2-phenylethenyl]-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 102369656 |
| Molecular Formula | C25H19N3O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 2-oxo-N,4-diphenyl-6-[(E)-2-phenylethenyl]-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1c(-c2ccccc2)nc(=O)[nH]c1/C=C/c1ccccc1 |
| InChI | InChI=1S/C25H19N3O2/c29-24(26-20-14-8-3-9-15-20)22-21(17-16-18-10-4-1-5-11-18)27-25(30)28-23(22)19-12-6-2-7-13-19/h1-17H,(H,26,29)(H,27,28,30)/b17-16+ |
| InChIKey | KPOWRUQXQYTLHQ-WUKNDPDISA-N |
| XLogP | 4.86 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |