C26H21N3O3 — CID 174445101
3-[[2-(2-methylphenyl)-5-(2-phenylethenyl)-1H-imidazole-4-carbonyl]amino]benzoic acid (PubChem CID 174445101) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is 3-[[2-(2-methylphenyl)-5-(2-phenylethenyl)-1H-imidazole-4-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[2-(2-methylphenyl)-5-(2-phenylethenyl)-1H-imidazole-4-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 174445101 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 3-[[2-(2-methylphenyl)-5-(2-phenylethenyl)-1H-imidazole-4-carbonyl]amino]benzoic acid |
| SMILES | Cc1ccccc1-c1nc(C(=O)Nc2cccc(C(=O)O)c2)c(C=Cc2ccccc2)[nH]1 |
| InChI | InChI=1S/C26H21N3O3/c1-17-8-5-6-13-21(17)24-28-22(15-14-18-9-3-2-4-10-18)23(29-24)25(30)27-20-12-7-11-19(16-20)26(31)32/h2-16H,1H3,(H,27,30)(H,28,29)(H,31,32) |
| InChIKey | FAXWHWYOMGFSMS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |