C17H13BrN2O3 — CID 167891028
3-[(5-bromo-7-methyl-1H-indole-2-carbonyl)amino]benzoic acid (PubChem CID 167891028) has the molecular formula C17H13BrN2O3 and a molecular weight of 373.21 g/mol. Its IUPAC name is 3-[(5-bromo-7-methyl-1H-indole-2-carbonyl)amino]benzoic acid.
| Compound Name | 3-[(5-bromo-7-methyl-1H-indole-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 167891028 |
| Molecular Formula | C17H13BrN2O3 |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 3-[(5-bromo-7-methyl-1H-indole-2-carbonyl)amino]benzoic acid |
| SMILES | Cc1cc(Br)cc2cc(C(=O)Nc3cccc(C(=O)O)c3)[nH]c12 |
| InChI | InChI=1S/C17H13BrN2O3/c1-9-5-12(18)6-11-8-14(20-15(9)11)16(21)19-13-4-2-3-10(7-13)17(22)23/h2-8,20H,1H3,(H,19,21)(H,22,23) |
| InChIKey | XQVFKNNCRIWGIB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |