C11H18N4O4S — CID 102370471
(2S)-2-[[2-[[2-(prop-2-enylcarbamothioylamino)acetyl]amino]acetyl]amino]propanoic acid (PubChem CID 102370471) has the molecular formula C11H18N4O4S and a molecular weight of 302.36 g/mol. Its IUPAC name is (2S)-2-[[2-[[2-(prop-2-enylcarbamothioylamino)acetyl]amino]acetyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-[[2-(prop-2-enylcarbamothioylamino)acetyl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 102370471 |
| Molecular Formula | C11H18N4O4S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (2S)-2-[[2-[[2-(prop-2-enylcarbamothioylamino)acetyl]amino]acetyl]amino]propanoic acid |
| SMILES | C=CCNC(=S)NCC(=O)NCC(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C11H18N4O4S/c1-3-4-12-11(20)14-5-8(16)13-6-9(17)15-7(2)10(18)19/h3,7H,1,4-6H2,2H3,(H,13,16)(H,15,17)(H,18,19)(H2,12,14,20)/t7-/m0/s1 |
| InChIKey | YCTCWIZCASRXHJ-ZETCQYMHSA-N |
| XLogP | -1.66 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|