C9H15N3O4 — CID 43466816
2-[[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]amino]propanoic acid (PubChem CID 43466816) has the molecular formula C9H15N3O4 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-[[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]amino]propanoic acid.
| Compound Name | 2-[[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43466816 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-[[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]amino]propanoic acid |
| SMILES | C=CCNC(=O)NC(=O)CNC(C)C(=O)O |
| InChI | InChI=1S/C9H15N3O4/c1-3-4-10-9(16)12-7(13)5-11-6(2)8(14)15/h3,6,11H,1,4-5H2,2H3,(H,14,15)(H2,10,12,13,16) |
| InChIKey | YTOCZKXQSYCJSQ-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|