C14H17ClFN3O2 — CID 97333693
2-[[(1S)-1-(3-chloro-4-fluorophenyl)ethyl]amino]-N-(prop-2-enylcarbamoyl)acetamide (PubChem CID 97333693) has the molecular formula C14H17ClFN3O2 and a molecular weight of 313.76 g/mol. Its IUPAC name is 2-[[(1S)-1-(3-chloro-4-fluorophenyl)ethyl]amino]-N-(prop-2-enylcarbamoyl)acetamide.
| Compound Name | 2-[[(1S)-1-(3-chloro-4-fluorophenyl)ethyl]amino]-N-(prop-2-enylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 97333693 |
| Molecular Formula | C14H17ClFN3O2 |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-[[(1S)-1-(3-chloro-4-fluorophenyl)ethyl]amino]-N-(prop-2-enylcarbamoyl)acetamide |
| SMILES | C=CCNC(=O)NC(=O)CN[C@@H](C)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClFN3O2/c1-3-6-17-14(21)19-13(20)8-18-9(2)10-4-5-12(16)11(15)7-10/h3-5,7,9,18H,1,6,8H2,2H3,(H2,17,19,20,21)/t9-/m0/s1 |
| InChIKey | VNAJIZDYMFCAAK-VIFPVBQESA-N |
| XLogP | 2.14 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|