C13H24O — CID 102371732
3-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2,2-dimethylpropan-1-ol (PubChem CID 102371732) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is 3-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 102371732 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | 3-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)CC1C[C@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C13H24O/c1-13(2,9-14)8-10-6-11-4-3-5-12(11)7-10/h10-12,14H,3-9H2,1-2H3/t10?,11-,12+ |
| InChIKey | UWHLHUPMXTXGRV-YOGCLGLASA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |