C19H21IN2O6 — CID 102372704
1-[(3aR,5R,6S,6aR)-5-(iodomethyl)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]pyrimidine-2,4-dione (PubChem CID 102372704) has the molecular formula C19H21IN2O6 and a molecular weight of 500.29 g/mol. Its IUPAC name is 1-[(3aR,5R,6S,6aR)-5-(iodomethyl)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3aR,5R,6S,6aR)-5-(iodomethyl)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102372704 |
| Molecular Formula | C19H21IN2O6 |
| Molecular Weight | 500.29 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | 1-[(3aR,5R,6S,6aR)-5-(iodomethyl)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]pyrimidine-2,4-dione |
| SMILES | CC1(C)O[C@H]2O[C@](CI)(n3ccc(=O)[nH]c3=O)[C@@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C19H21IN2O6/c1-18(2)26-14-15(25-10-12-6-4-3-5-7-12)19(11-20,28-16(14)27-18)22-9-8-13(23)21-17(22)24/h3-9,14-16H,10-11H2,1-2H3,(H,21,23,24)/t14-,15+,16+,19+/m1/s1 |
| InChIKey | FNDAJTPLPAROCO-DRMAHVMPSA-N |
| XLogP | 1.72 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|