C24H47F2NO2 — CID 102373407
2,2-difluoro-N,N-diheptyl-3-hydroxydecanamide (PubChem CID 102373407) has the molecular formula C24H47F2NO2 and a molecular weight of 419.64 g/mol. Its IUPAC name is 2,2-difluoro-N,N-diheptyl-3-hydroxydecanamide.
| Compound Name | 2,2-difluoro-N,N-diheptyl-3-hydroxydecanamide |
|---|---|
| PubChem CID | 102373407 |
| Molecular Formula | C24H47F2NO2 |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.36 |
| IUPAC Name | 2,2-difluoro-N,N-diheptyl-3-hydroxydecanamide |
| SMILES | CCCCCCCC(O)C(F)(F)C(=O)N(CCCCCCC)CCCCCCC |
| InChI | InChI=1S/C24H47F2NO2/c1-4-7-10-13-16-19-22(28)24(25,26)23(29)27(20-17-14-11-8-5-2)21-18-15-12-9-6-3/h22,28H,4-21H2,1-3H3 |
| InChIKey | HPODLTHHEQIDJQ-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|