C29H18N2O6 — CID 102373556
5,13-bis(3-nitrophenyl)tetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene-8,16-dione (PubChem CID 102373556) has the molecular formula C29H18N2O6 and a molecular weight of 490.47 g/mol. Its IUPAC name is 5,13-bis(3-nitrophenyl)tetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene-8,16-dione.
| Compound Name | 5,13-bis(3-nitrophenyl)tetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene-8,16-dione |
|---|---|
| PubChem CID | 102373556 |
| Molecular Formula | C29H18N2O6 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 5,13-bis(3-nitrophenyl)tetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene-8,16-dione |
| SMILES | O=C1c2cc(-c3cccc([N+](=O)[O-])c3)ccc2C2CC1c1ccc(-c3cccc([N+](=O)[O-])c3)cc1C2=O |
| InChI | InChI=1S/C29H18N2O6/c32-28-24-13-18(16-3-1-5-20(11-16)30(34)35)7-9-22(24)26-15-27(28)23-10-8-19(14-25(23)29(26)33)17-4-2-6-21(12-17)31(36)37/h1-14,26-27H,15H2 |
| InChIKey | ILLGZZYMZAOUAG-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|