C29H30O4 — CID 102376213
anthracen-9-ylmethyl 3-(1,2-dihydroxyheptyl)benzoate (PubChem CID 102376213) has the molecular formula C29H30O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is anthracen-9-ylmethyl 3-(1,2-dihydroxyheptyl)benzoate.
| Compound Name | anthracen-9-ylmethyl 3-(1,2-dihydroxyheptyl)benzoate |
|---|---|
| PubChem CID | 102376213 |
| Molecular Formula | C29H30O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | anthracen-9-ylmethyl 3-(1,2-dihydroxyheptyl)benzoate |
| SMILES | CCCCCC(O)C(O)c1cccc(C(=O)OCc2c3ccccc3cc3ccccc23)c1 |
| InChI | InChI=1S/C29H30O4/c1-2-3-4-16-27(30)28(31)22-12-9-13-23(18-22)29(32)33-19-26-24-14-7-5-10-20(24)17-21-11-6-8-15-25(21)26/h5-15,17-18,27-28,30-31H,2-4,16,19H2,1H3 |
| InChIKey | SWMJTSZKSDCSOA-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|