C28H20O4 — CID 102377956
2-(2,6-dimethoxyphenyl)-3-naphthalen-1-ylnaphthalene-1,4-dione (PubChem CID 102377956) has the molecular formula C28H20O4 and a molecular weight of 420.46 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenyl)-3-naphthalen-1-ylnaphthalene-1,4-dione.
| Compound Name | 2-(2,6-dimethoxyphenyl)-3-naphthalen-1-ylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 102377956 |
| Molecular Formula | C28H20O4 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-(2,6-dimethoxyphenyl)-3-naphthalen-1-ylnaphthalene-1,4-dione |
| SMILES | COc1cccc(OC)c1C1=C(c2cccc3ccccc23)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H20O4/c1-31-22-15-8-16-23(32-2)25(22)26-24(19-14-7-10-17-9-3-4-11-18(17)19)27(29)20-12-5-6-13-21(20)28(26)30/h3-16H,1-2H3 |
| InChIKey | MMQMNOPFBCMTQK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|