C11H14O5 — CID 102378011
(1S,2R,5R,6R,7R,9R)-12,12-dimethyl-3,8,11,13-tetraoxatetracyclo[7.4.0.02,6.05,7]tridecan-4-one (PubChem CID 102378011) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is (1S,2R,5R,6R,7R,9R)-12,12-dimethyl-3,8,11,13-tetraoxatetracyclo[7.4.0.02,6.05,7]tridecan-4-one.
| Compound Name | (1S,2R,5R,6R,7R,9R)-12,12-dimethyl-3,8,11,13-tetraoxatetracyclo[7.4.0.02,6.05,7]tridecan-4-one |
|---|---|
| PubChem CID | 102378011 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (1S,2R,5R,6R,7R,9R)-12,12-dimethyl-3,8,11,13-tetraoxatetracyclo[7.4.0.02,6.05,7]tridecan-4-one |
| SMILES | CC1(C)OC[C@H]2O[C@H]3[C@@H]4C(=O)O[C@@H]([C@@H]2O1)[C@@H]34 |
| InChI | InChI=1S/C11H14O5/c1-11(2)13-3-4-7(16-11)9-5-6(8(5)14-4)10(12)15-9/h4-9H,3H2,1-2H3/t4-,5-,6-,7-,8-,9-/m1/s1 |
| InChIKey | MFEJZJWMXOBMMV-OJEIPOMOSA-N |
| XLogP | 0.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |