C14H20N4O4S2 — CID 102379266
methyl 3-[(3aR,6aS)-3-acetyl-1,3a,6,6a-tetramethyl-2,5-bis(sulfanylidene)imidazo[4,5-d]imidazol-4-yl]-3-oxopropanoate (PubChem CID 102379266) has the molecular formula C14H20N4O4S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is methyl 3-[(3aR,6aS)-3-acetyl-1,3a,6,6a-tetramethyl-2,5-bis(sulfanylidene)imidazo[4,5-d]imidazol-4-yl]-3-oxopropanoate.
| Compound Name | methyl 3-[(3aR,6aS)-3-acetyl-1,3a,6,6a-tetramethyl-2,5-bis(sulfanylidene)imidazo[4,5-d]imidazol-4-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 102379266 |
| Molecular Formula | C14H20N4O4S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | methyl 3-[(3aR,6aS)-3-acetyl-1,3a,6,6a-tetramethyl-2,5-bis(sulfanylidene)imidazo[4,5-d]imidazol-4-yl]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)N1C(=S)N(C)[C@]2(C)N(C)C(=S)N(C(C)=O)[C@]12C |
| InChI | InChI=1S/C14H20N4O4S2/c1-8(19)17-11(23)15(4)13(2)14(17,3)18(12(24)16(13)5)9(20)7-10(21)22-6/h7H2,1-6H3/t13-,14+/m0/s1 |
| InChIKey | PSUVSGSFJBHTOG-UONOGXRCSA-N |
| XLogP | 0.12 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|