C18H36N4 — CID 102382107
2-(2-methylpropylideneamino)-N,N-bis[2-(2-methylpropylideneamino)ethyl]ethanamine (PubChem CID 102382107) has the molecular formula C18H36N4 and a molecular weight of 308.51 g/mol. Its IUPAC name is 2-(2-methylpropylideneamino)-N,N-bis[2-(2-methylpropylideneamino)ethyl]ethanamine.
| Compound Name | 2-(2-methylpropylideneamino)-N,N-bis[2-(2-methylpropylideneamino)ethyl]ethanamine |
|---|---|
| PubChem CID | 102382107 |
| Molecular Formula | C18H36N4 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.29 |
| IUPAC Name | 2-(2-methylpropylideneamino)-N,N-bis[2-(2-methylpropylideneamino)ethyl]ethanamine |
| SMILES | CC(C)/C=N/CCN(CC/N=C/C(C)C)CC/N=C/C(C)C |
| InChI | InChI=1S/C18H36N4/c1-16(2)13-19-7-10-22(11-8-20-14-17(3)4)12-9-21-15-18(5)6/h13-18H,7-12H2,1-6H3/b19-13+,20-14+,21-15+ |
| InChIKey | KOVIEQQJDLLRJK-KXVWNZKWSA-N |
| XLogP | 3.47 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|