C8H19N3 — CID 88832515
N'-[2-(2-methylpropylideneamino)ethyl]ethane-1,2-diamine (PubChem CID 88832515) has the molecular formula C8H19N3 and a molecular weight of 157.26 g/mol. Its IUPAC name is N'-[2-(2-methylpropylideneamino)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(2-methylpropylideneamino)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 88832515 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | N'-[2-(2-methylpropylideneamino)ethyl]ethane-1,2-diamine |
| SMILES | CC(C)/C=N/CCNCCN |
| InChI | InChI=1S/C8H19N3/c1-8(2)7-11-6-5-10-4-3-9/h7-8,10H,3-6,9H2,1-2H3/b11-7+ |
| InChIKey | ZXTGNDAXRVPBTD-YRNVUSSQSA-N |
| XLogP | 0.26 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|