C10H24N5O+ — CID 173273785
[[2-[2-(2-aminoethylamino)ethylimino]acetyl]amino]methyl-trimethylazanium (PubChem CID 173273785) has the molecular formula C10H24N5O+ and a molecular weight of 230.34 g/mol. Its IUPAC name is [[2-[2-(2-aminoethylamino)ethylimino]acetyl]amino]methyl-trimethylazanium.
| Compound Name | [[2-[2-(2-aminoethylamino)ethylimino]acetyl]amino]methyl-trimethylazanium |
|---|---|
| PubChem CID | 173273785 |
| Molecular Formula | C10H24N5O+ |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | [[2-[2-(2-aminoethylamino)ethylimino]acetyl]amino]methyl-trimethylazanium |
| SMILES | C[N+](C)(C)CNC(=O)/C=N/CCNCCN |
| InChI | InChI=1S/C10H23N5O/c1-15(2,3)9-14-10(16)8-13-7-6-12-5-4-11/h8,12H,4-7,9,11H2,1-3H3/p+1/b13-8+ |
| InChIKey | KKKLLGOFYSQGEZ-MDWZMJQESA-O |
| XLogP | -1.61 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|