C12H24N2 — CID 89312014
3-methyl-N'-(2-methylpropylidene)-2-propan-2-ylbutane-1,4-diimine (PubChem CID 89312014) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 3-methyl-N'-(2-methylpropylidene)-2-propan-2-ylbutane-1,4-diimine.
| Compound Name | 3-methyl-N'-(2-methylpropylidene)-2-propan-2-ylbutane-1,4-diimine |
|---|---|
| PubChem CID | 89312014 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 3-methyl-N'-(2-methylpropylidene)-2-propan-2-ylbutane-1,4-diimine |
| SMILES | [H]/N=C/C(C(C)C)C(C)C/N=C/C(C)C |
| InChI | InChI=1S/C12H24N2/c1-9(2)7-14-8-11(5)12(6-13)10(3)4/h6-7,9-13H,8H2,1-5H3/b13-6+,14-7+ |
| InChIKey | NUJDQHLKNYWPJU-AANLELRNSA-N |
| XLogP | 3.27 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|