C5H12NO2+ — CID 163682954
[(2R,3S)-3-hydroxy-4-imino-2-methylbutyl]oxidanium (PubChem CID 163682954) has the molecular formula C5H12NO2+ and a molecular weight of 118.16 g/mol. Its IUPAC name is [(2R,3S)-3-hydroxy-4-imino-2-methylbutyl]oxidanium.
| Compound Name | [(2R,3S)-3-hydroxy-4-imino-2-methylbutyl]oxidanium |
|---|---|
| PubChem CID | 163682954 |
| Molecular Formula | C5H12NO2+ |
| Molecular Weight | 118.16 g/mol |
| Exact Mass | 118.09 |
| IUPAC Name | [(2R,3S)-3-hydroxy-4-imino-2-methylbutyl]oxidanium |
| SMILES | [H]/N=C/[C@@H](O)[C@H](C)C[OH2+] |
| InChI | InChI=1S/C5H11NO2/c1-4(3-7)5(8)2-6/h2,4-8H,3H2,1H3/p+1/b6-2+/t4-,5-/m1/s1 |
| InChIKey | JMJBOILUJGKARB-KDNFLFBESA-O |
| XLogP | -0.64 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.16 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|