C6H13NO2 — CID 91152734
3-methanimidoylpentane-1,5-diol (PubChem CID 91152734) has the molecular formula C6H13NO2 and a molecular weight of 131.18 g/mol. Its IUPAC name is 3-methanimidoylpentane-1,5-diol.
| Compound Name | 3-methanimidoylpentane-1,5-diol |
|---|---|
| PubChem CID | 91152734 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 3-methanimidoylpentane-1,5-diol |
| SMILES | [H]/N=C/C(CCO)CCO |
| InChI | InChI=1S/C6H13NO2/c7-5-6(1-3-8)2-4-9/h5-9H,1-4H2/b7-5+ |
| InChIKey | DQHCEKRKFIFWQN-FNORWQNLSA-N |
| XLogP | 0.02 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|