C11H17N3 — CID 102382241
(1R,2R)-1-(1H-imidazol-2-yl)-2-methyl-N-prop-2-enylbut-3-en-1-amine (PubChem CID 102382241) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is (1R,2R)-1-(1H-imidazol-2-yl)-2-methyl-N-prop-2-enylbut-3-en-1-amine.
| Compound Name | (1R,2R)-1-(1H-imidazol-2-yl)-2-methyl-N-prop-2-enylbut-3-en-1-amine |
|---|---|
| PubChem CID | 102382241 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | (1R,2R)-1-(1H-imidazol-2-yl)-2-methyl-N-prop-2-enylbut-3-en-1-amine |
| SMILES | C=CCN[C@@H](c1ncc[nH]1)[C@H](C)C=C |
| InChI | InChI=1S/C11H17N3/c1-4-6-12-10(9(3)5-2)11-13-7-8-14-11/h4-5,7-10,12H,1-2,6H2,3H3,(H,13,14)/t9-,10-/m1/s1 |
| InChIKey | JUFZVZVPNFYVER-NXEZZACHSA-N |
| XLogP | 2.05 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|