C14H21NO5 — CID 102382717
methyl (1R,3R,7aR)-3-tert-butyl-1,6-dimethyl-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 102382717) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is methyl (1R,3R,7aR)-3-tert-butyl-1,6-dimethyl-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | methyl (1R,3R,7aR)-3-tert-butyl-1,6-dimethyl-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 102382717 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | methyl (1R,3R,7aR)-3-tert-butyl-1,6-dimethyl-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)C(C)C(=O)N1[C@@H](C(C)(C)C)O[C@@H]2C |
| InChI | InChI=1S/C14H21NO5/c1-7-9(16)14(12(18)19-6)8(2)20-11(13(3,4)5)15(14)10(7)17/h7-8,11H,1-6H3/t7?,8-,11-,14-/m1/s1 |
| InChIKey | MTNFHSWSXGRYIZ-JMLUSNMUSA-N |
| XLogP | 0.74 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|