C28H24O2 — CID 102383238
(1S,2R,3R,4S,5R)-3-ethenyl-1,2,4-triphenyl-9-oxatricyclo[3.3.1.02,4]nonan-6-one (PubChem CID 102383238) has the molecular formula C28H24O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is (1S,2R,3R,4S,5R)-3-ethenyl-1,2,4-triphenyl-9-oxatricyclo[3.3.1.02,4]nonan-6-one.
| Compound Name | (1S,2R,3R,4S,5R)-3-ethenyl-1,2,4-triphenyl-9-oxatricyclo[3.3.1.02,4]nonan-6-one |
|---|---|
| PubChem CID | 102383238 |
| Molecular Formula | C28H24O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (1S,2R,3R,4S,5R)-3-ethenyl-1,2,4-triphenyl-9-oxatricyclo[3.3.1.02,4]nonan-6-one |
| SMILES | C=C[C@@H]1[C@@]2(c3ccccc3)[C@H]3O[C@](c4ccccc4)(CCC3=O)[C@@]12c1ccccc1 |
| InChI | InChI=1S/C28H24O2/c1-2-24-27(21-14-8-4-9-15-21)25-23(29)18-19-26(30-25,20-12-6-3-7-13-20)28(24,27)22-16-10-5-11-17-22/h2-17,24-25H,1,18-19H2/t24-,25+,26+,27+,28-/m1/s1 |
| InChIKey | WAKNIZGNOCQONE-VNGQLYDISA-N |
| XLogP | 5.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|