C24H36O3 — CID 102383595
(8R,9S,10R,13S,14S,17S)-10,13,17-trimethyl-17-(oxolan-2-yloxy)-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 102383595) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-10,13,17-trimethyl-17-(oxolan-2-yloxy)-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S,17S)-10,13,17-trimethyl-17-(oxolan-2-yloxy)-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 102383595 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-10,13,17-trimethyl-17-(oxolan-2-yloxy)-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)CC1=CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(C)OC1CCCO1 |
| InChI | InChI=1S/C24H36O3/c1-22-11-8-17(25)15-16(22)6-7-18-19(22)9-12-23(2)20(18)10-13-24(23,3)27-21-5-4-14-26-21/h6,18-21H,4-5,7-15H2,1-3H3/t18-,19+,20+,21?,22+,23+,24+/m1/s1 |
| InChIKey | FDXZTMVWUAIKTN-BPOYVELMSA-N |
| XLogP | 5.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|