C9H9N3O5 — CID 102383620
N'-acetyl-2-hydroxy-5-nitrobenzohydrazide (PubChem CID 102383620) has the molecular formula C9H9N3O5 and a molecular weight of 239.19 g/mol. Its IUPAC name is N'-acetyl-2-hydroxy-5-nitrobenzohydrazide.
| Compound Name | N'-acetyl-2-hydroxy-5-nitrobenzohydrazide |
|---|---|
| PubChem CID | 102383620 |
| Molecular Formula | C9H9N3O5 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | N'-acetyl-2-hydroxy-5-nitrobenzohydrazide |
| SMILES | CC(=O)NNC(=O)c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C9H9N3O5/c1-5(13)10-11-9(15)7-4-6(12(16)17)2-3-8(7)14/h2-4,14H,1H3,(H,10,13)(H,11,15) |
| InChIKey | IIGXBPFZHFCKRI-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|