C16H12O — CID 102385197
8,10-dihydronaphtho[1,2-f][2]benzofuran (PubChem CID 102385197) has the molecular formula C16H12O and a molecular weight of 220.27 g/mol. Its IUPAC name is 8,10-dihydronaphtho[1,2-f][2]benzofuran.
| Compound Name | 8,10-dihydronaphtho[1,2-f][2]benzofuran |
|---|---|
| PubChem CID | 102385197 |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 8,10-dihydronaphtho[1,2-f][2]benzofuran |
| SMILES | c1ccc2c(c1)ccc1cc3c(cc12)COC3 |
| InChI | InChI=1S/C16H12O/c1-2-4-15-11(3-1)5-6-12-7-13-9-17-10-14(13)8-16(12)15/h1-8H,9-10H2 |
| InChIKey | VGMSBNUQXOACAV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|