C23H22N4O3S2 — CID 10238667
5-[[4-[2-[methyl-(6-phenylsulfanylpyrimidin-4-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 10238667) has the molecular formula C23H22N4O3S2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 5-[[4-[2-[methyl-(6-phenylsulfanylpyrimidin-4-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[methyl-(6-phenylsulfanylpyrimidin-4-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10238667 |
| Molecular Formula | C23H22N4O3S2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 5-[[4-[2-[methyl-(6-phenylsulfanylpyrimidin-4-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(CCOc1ccc(CC2SC(=O)NC2=O)cc1)c1cc(Sc2ccccc2)ncn1 |
| InChI | InChI=1S/C23H22N4O3S2/c1-27(20-14-21(25-15-24-20)31-18-5-3-2-4-6-18)11-12-30-17-9-7-16(8-10-17)13-19-22(28)26-23(29)32-19/h2-10,14-15,19H,11-13H2,1H3,(H,26,28,29) |
| InChIKey | XGPVXBAQXLGTLV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|