C22H14F5NOS — CID 102389426
(E)-3-[2-(2,3,4,5,6-pentafluorophenyl)sulfanylanilino]-1-phenylbut-2-en-1-one (PubChem CID 102389426) has the molecular formula C22H14F5NOS and a molecular weight of 435.42 g/mol. Its IUPAC name is (E)-3-[2-(2,3,4,5,6-pentafluorophenyl)sulfanylanilino]-1-phenylbut-2-en-1-one.
| Compound Name | (E)-3-[2-(2,3,4,5,6-pentafluorophenyl)sulfanylanilino]-1-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 102389426 |
| Molecular Formula | C22H14F5NOS |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | (E)-3-[2-(2,3,4,5,6-pentafluorophenyl)sulfanylanilino]-1-phenylbut-2-en-1-one |
| SMILES | C/C(=C\C(=O)c1ccccc1)Nc1ccccc1Sc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H14F5NOS/c1-12(11-15(29)13-7-3-2-4-8-13)28-14-9-5-6-10-16(14)30-22-20(26)18(24)17(23)19(25)21(22)27/h2-11,28H,1H3/b12-11+ |
| InChIKey | OJADWZYPHCBGLI-VAWYXSNFSA-N |
| XLogP | 6.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|