C26H27NO — CID 71027276
(Z)-3-[2-[2-(2,6-dimethylphenyl)ethyl]anilino]-1-phenylbut-2-en-1-one (PubChem CID 71027276) has the molecular formula C26H27NO and a molecular weight of 369.51 g/mol. Its IUPAC name is (Z)-3-[2-[2-(2,6-dimethylphenyl)ethyl]anilino]-1-phenylbut-2-en-1-one.
| Compound Name | (Z)-3-[2-[2-(2,6-dimethylphenyl)ethyl]anilino]-1-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 71027276 |
| Molecular Formula | C26H27NO |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (Z)-3-[2-[2-(2,6-dimethylphenyl)ethyl]anilino]-1-phenylbut-2-en-1-one |
| SMILES | C/C(=C/C(=O)c1ccccc1)Nc1ccccc1CCc1c(C)cccc1C |
| InChI | InChI=1S/C26H27NO/c1-19-10-9-11-20(2)24(19)17-16-22-12-7-8-15-25(22)27-21(3)18-26(28)23-13-5-4-6-14-23/h4-15,18,27H,16-17H2,1-3H3/b21-18- |
| InChIKey | BBYHWQPFUITZNR-UZYVYHOESA-N |
| XLogP | 6.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|