C41H42N2O2Se2 — CID 143582101
ethane;(Z)-1-phenyl-3-(2-phenylselanylanilino)but-2-en-1-one;(Z)-4-(2-phenylselanylanilino)pent-3-en-2-one (PubChem CID 143582101) has the molecular formula C41H42N2O2Se2 and a molecular weight of 752.72 g/mol. Its IUPAC name is ethane;(Z)-1-phenyl-3-(2-phenylselanylanilino)but-2-en-1-one;(Z)-4-(2-phenylselanylanilino)pent-3-en-2-one.
| Compound Name | ethane;(Z)-1-phenyl-3-(2-phenylselanylanilino)but-2-en-1-one;(Z)-4-(2-phenylselanylanilino)pent-3-en-2-one |
|---|---|
| PubChem CID | 143582101 |
| Molecular Formula | C41H42N2O2Se2 |
| Molecular Weight | 752.72 g/mol |
| Exact Mass | 754.16 |
| IUPAC Name | ethane;(Z)-1-phenyl-3-(2-phenylselanylanilino)but-2-en-1-one;(Z)-4-(2-phenylselanylanilino)pent-3-en-2-one |
| SMILES | C/C(=C/C(=O)c1ccccc1)Nc1ccccc1[Se]c1ccccc1.CC.CC(=O)/C=C(/C)Nc1ccccc1[Se]c1ccccc1 |
| InChI | InChI=1S/C22H19NOSe.C17H17NOSe.C2H6/c1-17(16-21(24)18-10-4-2-5-11-18)23-20-14-8-9-15-22(20)25-19-12-6-3-7-13-19;1-13(12-14(2)19)18-16-10-6-7-11-17(16)20-15-8-4-3-5-9-15;1-2/h2-16,23H,1H3;3-12,18H,1-2H3;1-2H3/b17-16-;13-12-; |
| InChIKey | NFQCYLVOUMNERK-ODJKEDHJSA-N |
| XLogP | 6.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.72 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|