About [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate
[(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate (PubChem CID 102395286) has the molecular formula C13H22F3NO3
and a molecular weight of 297.32 g/mol. Its IUPAC name is [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate.
Molecular Properties
| Compound Name | [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate |
| PubChem CID | 102395286 |
| Molecular Formula | C13H22F3NO3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate |
| SMILES | CCCC(=O)O[C@@](CC)(C(=O)NC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H22F3NO3/c1-6-8-9(18)20-12(7-2,13(14,15)16)10(19)17-11(3,4)5/h6-8H2,1-5H3,(H,17,19)/t12-/m0/s1 |
| InChIKey | ASJORVYAYCBZHO-LBPRGKRZSA-N |
| XLogP | 2.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate?
The IUPAC name of [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate (CID 102395286) is [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate.
What is the SMILES notation for [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate?
The canonical SMILES for [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate is CCCC(=O)O[C@@](CC)(C(=O)NC(C)(C)C)C(F)(F)F.
What is the InChIKey of [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate?
The InChIKey is ASJORVYAYCBZHO-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H22F3NO3/c1-6-8-9(18)20-12(7-2,13(14,15)16)10(19)17-11(3,4)5/h6-8H2,1-5H3,(H,17,19)/t12-/m0/s1.
What are the key properties of [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate?
[(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate has a molecular weight of 297.32 g/mol, XLogP of 2.96, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate is sourced from PubChem (CID 102395286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).