C13H22F3NO3 — CID 102395286
[(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate (PubChem CID 102395286) has the molecular formula C13H22F3NO3 and a molecular weight of 297.32 g/mol. Its IUPAC name is [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate.
| Compound Name | [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate |
|---|---|
| PubChem CID | 102395286 |
| Molecular Formula | C13H22F3NO3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | [(2S)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] butanoate |
| SMILES | CCCC(=O)O[C@@](CC)(C(=O)NC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H22F3NO3/c1-6-8-9(18)20-12(7-2,13(14,15)16)10(19)17-11(3,4)5/h6-8H2,1-5H3,(H,17,19)/t12-/m0/s1 |
| InChIKey | ASJORVYAYCBZHO-LBPRGKRZSA-N |
| XLogP | 2.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |