C10H10O5 — CID 102396426
2-acetyl-3,4-dihydroxy-5-methoxybenzaldehyde (PubChem CID 102396426) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is 2-acetyl-3,4-dihydroxy-5-methoxybenzaldehyde.
| Compound Name | 2-acetyl-3,4-dihydroxy-5-methoxybenzaldehyde |
|---|---|
| PubChem CID | 102396426 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2-acetyl-3,4-dihydroxy-5-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)c(C(C)=O)c(O)c1O |
| InChI | InChI=1S/C10H10O5/c1-5(12)8-6(4-11)3-7(15-2)9(13)10(8)14/h3-4,13-14H,1-2H3 |
| InChIKey | NAGNMDSPTSXCBY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|