C21H21N — CID 102396448
2-[(E)-1,3-bis(4-methylphenyl)prop-2-enyl]-1H-pyrrole (PubChem CID 102396448) has the molecular formula C21H21N and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-[(E)-1,3-bis(4-methylphenyl)prop-2-enyl]-1H-pyrrole.
| Compound Name | 2-[(E)-1,3-bis(4-methylphenyl)prop-2-enyl]-1H-pyrrole |
|---|---|
| PubChem CID | 102396448 |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-[(E)-1,3-bis(4-methylphenyl)prop-2-enyl]-1H-pyrrole |
| SMILES | Cc1ccc(/C=C/C(c2ccc(C)cc2)c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C21H21N/c1-16-5-9-18(10-6-16)11-14-20(21-4-3-15-22-21)19-12-7-17(2)8-13-19/h3-15,20,22H,1-2H3/b14-11+ |
| InChIKey | LJFZQRBPXGJAEJ-SDNWHVSQSA-N |
| XLogP | 5.48 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |