C18H42Si4 — CID 102397181
trimethyl-[(1E,3S,4R,5E)-1,4,6-tris(trimethylsilyl)hexa-1,5-dien-3-yl]silane (PubChem CID 102397181) has the molecular formula C18H42Si4 and a molecular weight of 370.88 g/mol. Its IUPAC name is trimethyl-[(1E,3S,4R,5E)-1,4,6-tris(trimethylsilyl)hexa-1,5-dien-3-yl]silane.
| Compound Name | trimethyl-[(1E,3S,4R,5E)-1,4,6-tris(trimethylsilyl)hexa-1,5-dien-3-yl]silane |
|---|---|
| PubChem CID | 102397181 |
| Molecular Formula | C18H42Si4 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | trimethyl-[(1E,3S,4R,5E)-1,4,6-tris(trimethylsilyl)hexa-1,5-dien-3-yl]silane |
| SMILES | C[Si](C)(C)/C=C/[C@H]([C@H](/C=C/[Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H42Si4/c1-19(2,3)15-13-17(21(7,8)9)18(22(10,11)12)14-16-20(4,5)6/h13-18H,1-12H3/b15-13+,16-14+/t17-,18+ |
| InChIKey | GKTVETMTGPNXIN-JHKMRUOLSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|