C13H28O2Si2 — CID 134967368
(E,5S)-7-trimethylsilyl-5-trimethylsilyloxyhept-6-en-2-one (PubChem CID 134967368) has the molecular formula C13H28O2Si2 and a molecular weight of 272.54 g/mol. Its IUPAC name is (E,5S)-7-trimethylsilyl-5-trimethylsilyloxyhept-6-en-2-one.
| Compound Name | (E,5S)-7-trimethylsilyl-5-trimethylsilyloxyhept-6-en-2-one |
|---|---|
| PubChem CID | 134967368 |
| Molecular Formula | C13H28O2Si2 |
| Molecular Weight | 272.54 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (E,5S)-7-trimethylsilyl-5-trimethylsilyloxyhept-6-en-2-one |
| SMILES | CC(=O)CC[C@@H](/C=C/[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H28O2Si2/c1-12(14)8-9-13(15-17(5,6)7)10-11-16(2,3)4/h10-11,13H,8-9H2,1-7H3/b11-10+/t13-/m0/s1 |
| InChIKey | MNHSBISCCUXRNZ-NHAQELONSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|