C10H24OSi2 — CID 85440196
1,4-bis(trimethylsilyl)but-3-en-2-ol (PubChem CID 85440196) has the molecular formula C10H24OSi2 and a molecular weight of 216.47 g/mol. Its IUPAC name is 1,4-bis(trimethylsilyl)but-3-en-2-ol.
| Compound Name | 1,4-bis(trimethylsilyl)but-3-en-2-ol |
|---|---|
| PubChem CID | 85440196 |
| Molecular Formula | C10H24OSi2 |
| Molecular Weight | 216.47 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1,4-bis(trimethylsilyl)but-3-en-2-ol |
| SMILES | C[Si](C)(C)C=CC(O)C[Si](C)(C)C |
| InChI | InChI=1S/C10H24OSi2/c1-12(2,3)8-7-10(11)9-13(4,5)6/h7-8,10-11H,9H2,1-6H3 |
| InChIKey | YVYIQXFPYQSDRA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|