C17H20N2O2S — CID 102397213
1-[(2S,3aR,6aS)-2-(4-methylphenyl)sulfanyl-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]-3-diazopropan-2-one (PubChem CID 102397213) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-[(2S,3aR,6aS)-2-(4-methylphenyl)sulfanyl-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]-3-diazopropan-2-one.
| Compound Name | 1-[(2S,3aR,6aS)-2-(4-methylphenyl)sulfanyl-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]-3-diazopropan-2-one |
|---|---|
| PubChem CID | 102397213 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-[(2S,3aR,6aS)-2-(4-methylphenyl)sulfanyl-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]-3-diazopropan-2-one |
| SMILES | Cc1ccc(S[C@H]2C[C@H]3CCC[C@@]3(CC(=O)C=[N+]=[N-])O2)cc1 |
| InChI | InChI=1S/C17H20N2O2S/c1-12-4-6-15(7-5-12)22-16-9-13-3-2-8-17(13,21-16)10-14(20)11-19-18/h4-7,11,13,16H,2-3,8-10H2,1H3/t13-,16+,17+/m1/s1 |
| InChIKey | MQZIPUYBLNROAX-COXVUDFISA-N |
| XLogP | 3.63 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|