C35H46O4Si — CID 102397237
tert-butyl-diphenyl-[(2S)-2-[(2S,5S,7S)-2-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]decan-7-yl]propoxy]silane (PubChem CID 102397237) has the molecular formula C35H46O4Si and a molecular weight of 558.84 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(2S)-2-[(2S,5S,7S)-2-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]decan-7-yl]propoxy]silane.
| Compound Name | tert-butyl-diphenyl-[(2S)-2-[(2S,5S,7S)-2-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]decan-7-yl]propoxy]silane |
|---|---|
| PubChem CID | 102397237 |
| Molecular Formula | C35H46O4Si |
| Molecular Weight | 558.84 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | tert-butyl-diphenyl-[(2S)-2-[(2S,5S,7S)-2-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]decan-7-yl]propoxy]silane |
| SMILES | C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1CCC[C@]2(CC[C@@H](COCc3ccccc3)O2)O1 |
| InChI | InChI=1S/C35H46O4Si/c1-28(25-37-40(34(2,3)4,31-17-10-6-11-18-31)32-19-12-7-13-20-32)33-21-14-23-35(39-33)24-22-30(38-35)27-36-26-29-15-8-5-9-16-29/h5-13,15-20,28,30,33H,14,21-27H2,1-4H3/t28-,30-,33-,35+/m0/s1 |
| InChIKey | SDVQGIACLFJCQX-JPNFFBNVSA-N |
| XLogP | 6.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.84 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|