C32H41N2P2Si2- — CID 102397908
[[[methyl(trimethylsilyl)amino]-diphenyl-λ5-phosphanylidene]methylidene-diphenyl-λ5-phosphanyl]-trimethylsilylazanide (PubChem CID 102397908) has the molecular formula C32H41N2P2Si2- and a molecular weight of 571.81 g/mol. Its IUPAC name is [[[methyl(trimethylsilyl)amino]-diphenyl-λ5-phosphanylidene]methylidene-diphenyl-λ5-phosphanyl]-trimethylsilylazanide.
| Compound Name | [[[methyl(trimethylsilyl)amino]-diphenyl-λ5-phosphanylidene]methylidene-diphenyl-λ5-phosphanyl]-trimethylsilylazanide |
|---|---|
| PubChem CID | 102397908 |
| Molecular Formula | C32H41N2P2Si2- |
| Molecular Weight | 571.81 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | [[[methyl(trimethylsilyl)amino]-diphenyl-λ5-phosphanylidene]methylidene-diphenyl-λ5-phosphanyl]-trimethylsilylazanide |
| SMILES | CN([Si](C)(C)C)P(=C=P([N-][Si](C)(C)C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H41N2P2Si2/c1-34(38(5,6)7)36(31-24-16-10-17-25-31,32-26-18-11-19-27-32)28-35(33-37(2,3)4,29-20-12-8-13-21-29)30-22-14-9-15-23-30/h8-27H,1-7H3/q-1 |
| InChIKey | PUWAMZKFRUVQCK-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.81 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|